C11H13NOS — CID 107028048
1-(1,3-dihydroisoindol-2-yl)-2-sulfanylpropan-1-one (PubChem CID 107028048) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)-2-sulfanylpropan-1-one.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)-2-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 107028048 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)-2-sulfanylpropan-1-one |
| SMILES | CC(S)C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H13NOS/c1-8(14)11(13)12-6-9-4-2-3-5-10(9)7-12/h2-5,8,14H,6-7H2,1H3 |
| InChIKey | FSYNPWRKPAJBFO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|