C7H11N3O2 — CID 66061276
4-propanimidoylpiperazine-2,6-dione (PubChem CID 66061276) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-propanimidoylpiperazine-2,6-dione.
| Compound Name | 4-propanimidoylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66061276 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-propanimidoylpiperazine-2,6-dione |
| SMILES | [H]/N=C(\CC)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C7H11N3O2/c1-2-5(8)10-3-6(11)9-7(12)4-10/h8H,2-4H2,1H3,(H,9,11,12)/b8-5+ |
| InChIKey | YSIIMJLUVBZSIJ-VMPITWQZSA-N |
| XLogP | -0.67 |
| TPSA | 73.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|