C31H31N3 — CID 142911086
N-imino-4-methyl-3-(2-methylphenyl)benzenecarboximidamide;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene (PubChem CID 142911086) has the molecular formula C31H31N3 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-imino-4-methyl-3-(2-methylphenyl)benzenecarboximidamide;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene.
| Compound Name | N-imino-4-methyl-3-(2-methylphenyl)benzenecarboximidamide;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 142911086 |
| Molecular Formula | C31H31N3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-imino-4-methyl-3-(2-methylphenyl)benzenecarboximidamide;2-methyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene |
| SMILES | CC1c2ccccc2CCc2ccccc21.[H]/N=C(\N=N\[H])c1ccc(C)c(-c2ccccc2C)c1 |
| InChI | InChI=1S/C16H16.C15H15N3/c1-12-15-8-4-2-6-13(15)10-11-14-7-3-5-9-16(12)14;1-10-5-3-4-6-13(10)14-9-12(15(16)18-17)8-7-11(14)2/h2-9,12H,10-11H2,1H3;3-9,16-17H,1-2H3/b;16-15-,18-17+ |
| InChIKey | TTXRQCGXIOZIBR-JEBNNUJKSA-N |
| XLogP | 8.26 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|