C40H29N3 — CID 145340384
N'-[3-(21-pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaenyl)benzenecarboximidoyl]-5,6-dihydronaphthalene-2-carboximidamide (PubChem CID 145340384) has the molecular formula C40H29N3 and a molecular weight of 551.69 g/mol. Its IUPAC name is N'-[3-(21-pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaenyl)benzenecarboximidoyl]-5,6-dihydronaphthalene-2-carboximidamide.
| Compound Name | N'-[3-(21-pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaenyl)benzenecarboximidoyl]-5,6-dihydronaphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 145340384 |
| Molecular Formula | C40H29N3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N'-[3-(21-pentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15,17,19,21-undecaenyl)benzenecarboximidoyl]-5,6-dihydronaphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N=C(/N)c1ccc2c(c1)C=CCC2)c1cccc(-c2cc3c4ccccc4c4ccccc4c3c3ccccc23)c1 |
| InChI | InChI=1S/C40H29N3/c41-39(43-40(42)29-21-20-25-10-1-2-11-26(25)22-29)28-13-9-12-27(23-28)36-24-37-32-16-4-3-14-30(32)31-15-5-7-18-34(31)38(37)35-19-8-6-17-33(35)36/h2-9,11-24H,1,10H2,(H3,41,42,43) |
| InChIKey | XCPYEOHECPPSHP-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|