C10H8BrNO — CID 24767137
(1R,2R)-2-bromo-1-isocyanato-2,3-dihydro-1H-indene (PubChem CID 24767137) has the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. Its IUPAC name is (1R,2R)-2-bromo-1-isocyanato-2,3-dihydro-1H-indene.
| Compound Name | (1R,2R)-2-bromo-1-isocyanato-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 24767137 |
| Molecular Formula | C10H8BrNO |
| Molecular Weight | 238.08 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | (1R,2R)-2-bromo-1-isocyanato-2,3-dihydro-1H-indene |
| SMILES | O=C=N[C@@H]1c2ccccc2C[C@H]1Br |
| InChI | InChI=1S/C10H8BrNO/c11-9-5-7-3-1-2-4-8(7)10(9)12-6-13/h1-4,9-10H,5H2/t9-,10-/m1/s1 |
| InChIKey | SEXWYZQOBHSOTC-NXEZZACHSA-N |
| XLogP | 2.38 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.08 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|