C12H16O — CID 123616852
3-ethyl-2-methylcyclonona-2,4,6-trien-1-one (PubChem CID 123616852) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-ethyl-2-methylcyclonona-2,4,6-trien-1-one.
| Compound Name | 3-ethyl-2-methylcyclonona-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 123616852 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-ethyl-2-methylcyclonona-2,4,6-trien-1-one |
| SMILES | CCC1=C(C)C(=O)CCC=CC=C1 |
| InChI | InChI=1S/C12H16O/c1-3-11-8-6-4-5-7-9-12(13)10(11)2/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | VLKFIOLLJVGAOW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |