C13H23N — CID 144554138
ethane;N-(2-methylcyclohexa-1,3-dien-1-yl)butan-2-imine (PubChem CID 144554138) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is ethane;N-(2-methylcyclohexa-1,3-dien-1-yl)butan-2-imine.
| Compound Name | ethane;N-(2-methylcyclohexa-1,3-dien-1-yl)butan-2-imine |
|---|---|
| PubChem CID | 144554138 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | ethane;N-(2-methylcyclohexa-1,3-dien-1-yl)butan-2-imine |
| SMILES | CC.CC/C(C)=N/C1=C(C)C=CCC1 |
| InChI | InChI=1S/C11H17N.C2H6/c1-4-10(3)12-11-8-6-5-7-9(11)2;1-2/h5,7H,4,6,8H2,1-3H3;1-2H3/b12-10+; |
| InChIKey | BPQBGFUJORTNIJ-VHPXAQPISA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|