C8H10ClNS — CID 163629393
N-(2-sulfanylcyclohexa-1,3-dien-1-yl)ethanimidoyl chloride (PubChem CID 163629393) has the molecular formula C8H10ClNS and a molecular weight of 187.70 g/mol. Its IUPAC name is N-(2-sulfanylcyclohexa-1,3-dien-1-yl)ethanimidoyl chloride.
| Compound Name | N-(2-sulfanylcyclohexa-1,3-dien-1-yl)ethanimidoyl chloride |
|---|---|
| PubChem CID | 163629393 |
| Molecular Formula | C8H10ClNS |
| Molecular Weight | 187.70 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | N-(2-sulfanylcyclohexa-1,3-dien-1-yl)ethanimidoyl chloride |
| SMILES | C/C(Cl)=N\C1=C(S)C=CCC1 |
| InChI | InChI=1S/C8H10ClNS/c1-6(9)10-7-4-2-3-5-8(7)11/h3,5,11H,2,4H2,1H3/b10-6+ |
| InChIKey | HUUHXNWSKNBUTM-UXBLZVDNSA-N |
| XLogP | 3.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|