C17H19NO — CID 143288649
1-[2-(1-cyclohepta-1,4,6-trien-1-ylethylideneamino)cyclohexa-1,5-dien-1-yl]ethanone (PubChem CID 143288649) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-[2-(1-cyclohepta-1,4,6-trien-1-ylethylideneamino)cyclohexa-1,5-dien-1-yl]ethanone.
| Compound Name | 1-[2-(1-cyclohepta-1,4,6-trien-1-ylethylideneamino)cyclohexa-1,5-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 143288649 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-[2-(1-cyclohepta-1,4,6-trien-1-ylethylideneamino)cyclohexa-1,5-dien-1-yl]ethanone |
| SMILES | CC(=O)C1=C(/N=C(\C)C2=CCC=CC=C2)CCC=C1 |
| InChI | InChI=1S/C17H19NO/c1-13(15-9-5-3-4-6-10-15)18-17-12-8-7-11-16(17)14(2)19/h3-5,7,9-11H,6,8,12H2,1-2H3/b18-13+ |
| InChIKey | PHXRTULTDGTTCJ-QGOAFFKASA-N |
| XLogP | 4.08 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|