C21H22O2 — CID 144689388
1-cyclohepta-1,4,6-trien-1-yl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione (PubChem CID 144689388) has the molecular formula C21H22O2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-cyclohepta-1,4,6-trien-1-yl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione.
| Compound Name | 1-cyclohepta-1,4,6-trien-1-yl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 144689388 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-cyclohepta-1,4,6-trien-1-yl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCCC2)C1=CCC=CC=C1 |
| InChI | InChI=1S/C21H22O2/c22-20(17-8-3-1-2-4-9-17)13-14-21(23)19-12-11-16-7-5-6-10-18(16)15-19/h1-3,8-9,11-12,15H,4-7,10,13-14H2 |
| InChIKey | NTOGMBAMXVNWSZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |