C21H23FO2 — CID 138480483
1-(2-fluorocyclohepta-1,5-dien-1-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione (PubChem CID 138480483) has the molecular formula C21H23FO2 and a molecular weight of 326.41 g/mol. Its IUPAC name is 1-(2-fluorocyclohepta-1,5-dien-1-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione.
| Compound Name | 1-(2-fluorocyclohepta-1,5-dien-1-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 138480483 |
| Molecular Formula | C21H23FO2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-(2-fluorocyclohepta-1,5-dien-1-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)CCCC2)C1=C(F)CCC=CC1 |
| InChI | InChI=1S/C21H23FO2/c22-19-9-3-1-2-8-18(19)21(24)13-12-20(23)17-11-10-15-6-4-5-7-16(15)14-17/h1-2,10-11,14H,3-9,12-13H2 |
| InChIKey | PAXZQWIRHASJEI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|