C11H12O — CID 177036097
4-methyl-7,8-dihydronaphthalen-2-ol (PubChem CID 177036097) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-methyl-7,8-dihydronaphthalen-2-ol.
| Compound Name | 4-methyl-7,8-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 177036097 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | 4-methyl-7,8-dihydronaphthalen-2-ol |
| SMILES | Cc1cc(O)cc2c1C=CCC2 |
| InChI | InChI=1S/C11H12O/c1-8-6-10(12)7-9-4-2-3-5-11(8)9/h3,5-7,12H,2,4H2,1H3 |
| InChIKey | CFBQKNZFLMTWFD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |