C9H11NO3 — CID 54566838
2-methoxy-4,5-dihydroisoindole-1,3-diol (PubChem CID 54566838) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-methoxy-4,5-dihydroisoindole-1,3-diol.
| Compound Name | 2-methoxy-4,5-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54566838 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-methoxy-4,5-dihydroisoindole-1,3-diol |
| SMILES | COn1c(O)c2c(c1O)CCC=C2 |
| InChI | InChI=1S/C9H11NO3/c1-13-10-8(11)6-4-2-3-5-7(6)9(10)12/h2,4,11-12H,3,5H2,1H3 |
| InChIKey | ZUKUDPMGMKRIGB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |