C11H13NO — CID 123660793
2,4-dimethyl-5,6-dihydroquinolin-3-ol (PubChem CID 123660793) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,4-dimethyl-5,6-dihydroquinolin-3-ol.
| Compound Name | 2,4-dimethyl-5,6-dihydroquinolin-3-ol |
|---|---|
| PubChem CID | 123660793 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2,4-dimethyl-5,6-dihydroquinolin-3-ol |
| SMILES | Cc1nc2c(c(C)c1O)CCC=C2 |
| InChI | InChI=1S/C11H13NO/c1-7-9-5-3-4-6-10(9)12-8(2)11(7)13/h4,6,13H,3,5H2,1-2H3 |
| InChIKey | SPKBLBQLKVWFTD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |