About methane;3,4,5-trimethylphenol
methane;3,4,5-trimethylphenol (PubChem CID 174273113) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is methane;3,4,5-trimethylphenol.
Molecular Properties
| Compound Name | methane;3,4,5-trimethylphenol |
| PubChem CID | 174273113 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | methane;3,4,5-trimethylphenol |
| SMILES | C.Cc1cc(O)cc(C)c1C |
| InChI | InChI=1S/C9H12O.CH4/c1-6-4-9(10)5-7(2)8(6)3;/h4-5,10H,1-3H3;1H4 |
| InChIKey | LSUIBVPXIRKSII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;3,4,5-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3,4,5-trimethylphenol?
The IUPAC name of methane;3,4,5-trimethylphenol (CID 174273113) is methane;3,4,5-trimethylphenol.
What is the SMILES notation for methane;3,4,5-trimethylphenol?
The canonical SMILES for methane;3,4,5-trimethylphenol is C.Cc1cc(O)cc(C)c1C.
What is the InChIKey of methane;3,4,5-trimethylphenol?
The InChIKey is LSUIBVPXIRKSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.CH4/c1-6-4-9(10)5-7(2)8(6)3;/h4-5,10H,1-3H3;1H4.
What are the key properties of methane;3,4,5-trimethylphenol?
methane;3,4,5-trimethylphenol has a molecular weight of 152.24 g/mol, XLogP of 2.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3,4,5-trimethylphenol is sourced from PubChem (CID 174273113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).