C10H16O — CID 174273113
methane;3,4,5-trimethylphenol (PubChem CID 174273113) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is methane;3,4,5-trimethylphenol.
| Compound Name | methane;3,4,5-trimethylphenol |
|---|---|
| PubChem CID | 174273113 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | methane;3,4,5-trimethylphenol |
| SMILES | C.Cc1cc(O)cc(C)c1C |
| InChI | InChI=1S/C9H12O.CH4/c1-6-4-9(10)5-7(2)8(6)3;/h4-5,10H,1-3H3;1H4 |
| InChIKey | LSUIBVPXIRKSII-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |