C9H15N3 — CID 142057460
N-methyl-N'-[2-(methylideneamino)cyclohexa-1,5-dien-1-yl]methanediamine (PubChem CID 142057460) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N-methyl-N'-[2-(methylideneamino)cyclohexa-1,5-dien-1-yl]methanediamine.
| Compound Name | N-methyl-N'-[2-(methylideneamino)cyclohexa-1,5-dien-1-yl]methanediamine |
|---|---|
| PubChem CID | 142057460 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-methyl-N'-[2-(methylideneamino)cyclohexa-1,5-dien-1-yl]methanediamine |
| SMILES | C=NC1=C(NCNC)C=CCC1 |
| InChI | InChI=1S/C9H15N3/c1-10-7-12-9-6-4-3-5-8(9)11-2/h4,6,10,12H,2-3,5,7H2,1H3 |
| InChIKey | AYXPWOUVIIKBLR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|