C13H12O5 — CID 54060290
1-O-ethyl 2-O-(6-oxo-8-bicyclo[5.2.0]nona-1(7),4,8-trienyl) oxalate (PubChem CID 54060290) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is 1-O-ethyl 2-O-(6-oxo-8-bicyclo[5.2.0]nona-1(7),4,8-trienyl) oxalate.
| Compound Name | 1-O-ethyl 2-O-(6-oxo-8-bicyclo[5.2.0]nona-1(7),4,8-trienyl) oxalate |
|---|---|
| PubChem CID | 54060290 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-O-ethyl 2-O-(6-oxo-8-bicyclo[5.2.0]nona-1(7),4,8-trienyl) oxalate |
| SMILES | CCOC(=O)C(=O)OC1=CC2=C1C(=O)C=CCC2 |
| InChI | InChI=1S/C13H12O5/c1-2-17-12(15)13(16)18-10-7-8-5-3-4-6-9(14)11(8)10/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | LZFHMKRFIPGWPC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|