C12H14O3 — CID 15093088
ethyl (3E)-3-ethylidene-4-oxocyclohepta-1,5-diene-1-carboxylate (PubChem CID 15093088) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethyl (3E)-3-ethylidene-4-oxocyclohepta-1,5-diene-1-carboxylate.
| Compound Name | ethyl (3E)-3-ethylidene-4-oxocyclohepta-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 15093088 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethyl (3E)-3-ethylidene-4-oxocyclohepta-1,5-diene-1-carboxylate |
| SMILES | C/C=C1\C=C(C(=O)OCC)CC=CC1=O |
| InChI | InChI=1S/C12H14O3/c1-3-9-8-10(12(14)15-4-2)6-5-7-11(9)13/h3,5,7-8H,4,6H2,1-2H3/b9-3+ |
| InChIKey | BCGOTQANBUADKY-YCRREMRBSA-N |
| XLogP | 1.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|