C16H22O4 — CID 66809425
dipropyl 4-methylcyclohepta-1,3,6-triene-1,2-dicarboxylate (PubChem CID 66809425) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is dipropyl 4-methylcyclohepta-1,3,6-triene-1,2-dicarboxylate.
| Compound Name | dipropyl 4-methylcyclohepta-1,3,6-triene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66809425 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | dipropyl 4-methylcyclohepta-1,3,6-triene-1,2-dicarboxylate |
| SMILES | CCCOC(=O)C1=C(C(=O)OCCC)C=C(C)CC=C1 |
| InChI | InChI=1S/C16H22O4/c1-4-9-19-15(17)13-8-6-7-12(3)11-14(13)16(18)20-10-5-2/h6,8,11H,4-5,7,9-10H2,1-3H3 |
| InChIKey | FKSAIYDDIBBXEQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |