C10H14N2O2 — CID 104671102
propyl 3,6-dimethylpyridazine-4-carboxylate (PubChem CID 104671102) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is propyl 3,6-dimethylpyridazine-4-carboxylate.
| Compound Name | propyl 3,6-dimethylpyridazine-4-carboxylate |
|---|---|
| PubChem CID | 104671102 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | propyl 3,6-dimethylpyridazine-4-carboxylate |
| SMILES | CCCOC(=O)c1cc(C)nnc1C |
| InChI | InChI=1S/C10H14N2O2/c1-4-5-14-10(13)9-6-7(2)11-12-8(9)3/h6H,4-5H2,1-3H3 |
| InChIKey | CJACYWHMFYPGHN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |