C12H18N2O — CID 105087649
1-(3,6-dimethylpyridazin-4-yl)hexan-1-one (PubChem CID 105087649) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)hexan-1-one.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)hexan-1-one |
|---|---|
| PubChem CID | 105087649 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)hexan-1-one |
| SMILES | CCCCCC(=O)c1cc(C)nnc1C |
| InChI | InChI=1S/C12H18N2O/c1-4-5-6-7-12(15)11-8-9(2)13-14-10(11)3/h8H,4-7H2,1-3H3 |
| InChIKey | UANZXKXSTXNSHU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|