C13H18O5 — CID 174383205
cyclohexa-2,5-diene-1,4-dione;dipropyl carbonate (PubChem CID 174383205) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;dipropyl carbonate.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;dipropyl carbonate |
|---|---|
| PubChem CID | 174383205 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;dipropyl carbonate |
| SMILES | CCCOC(=O)OCCC.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C7H14O3.C6H4O2/c1-3-5-9-7(8)10-6-4-2;7-5-1-2-6(8)4-3-5/h3-6H2,1-2H3;1-4H |
| InChIKey | BCIOMXMCGYRSIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|