About ethyl 1H-indene-2-carboxylate
ethyl 1H-indene-2-carboxylate (PubChem CID 15378309) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is ethyl 1H-indene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1H-indene-2-carboxylate |
| PubChem CID | 15378309 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | ethyl 1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C12H12O2/c1-2-14-12(13)11-7-9-5-3-4-6-10(9)8-11/h3-7H,2,8H2,1H3 |
| InChIKey | XQKOXWIOMWAGIY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 1H-indene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1H-indene-2-carboxylate?
The IUPAC name of ethyl 1H-indene-2-carboxylate (CID 15378309) is ethyl 1H-indene-2-carboxylate.
What is the SMILES notation for ethyl 1H-indene-2-carboxylate?
The canonical SMILES for ethyl 1H-indene-2-carboxylate is CCOC(=O)C1=Cc2ccccc2C1.
What is the InChIKey of ethyl 1H-indene-2-carboxylate?
The InChIKey is XQKOXWIOMWAGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-14-12(13)11-7-9-5-3-4-6-10(9)8-11/h3-7H,2,8H2,1H3.
What are the key properties of ethyl 1H-indene-2-carboxylate?
ethyl 1H-indene-2-carboxylate has a molecular weight of 188.23 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1H-indene-2-carboxylate is sourced from PubChem (CID 15378309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).