C21H22O5 — CID 56651449
ethyl 5,13,14-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene-9-carboxylate (PubChem CID 56651449) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is ethyl 5,13,14-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene-9-carboxylate.
| Compound Name | ethyl 5,13,14-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene-9-carboxylate |
|---|---|
| PubChem CID | 56651449 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | ethyl 5,13,14-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,8,11,13-heptaene-9-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(OC)ccc2-c2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C21H22O5/c1-5-26-21(22)15-8-13-10-16(23-2)6-7-17(13)18-12-20(25-4)19(24-3)11-14(18)9-15/h6-8,10-12H,5,9H2,1-4H3 |
| InChIKey | RSIXOKYFEMRQOO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |