C25H25NO6S — CID 71701806
ethyl 6,7-dimethoxy-2-[[2-(4-methoxyphenyl)acetyl]amino]-4H-indeno[2,1-b]thiophene-1-carboxylate (PubChem CID 71701806) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is ethyl 6,7-dimethoxy-2-[[2-(4-methoxyphenyl)acetyl]amino]-4H-indeno[2,1-b]thiophene-1-carboxylate.
| Compound Name | ethyl 6,7-dimethoxy-2-[[2-(4-methoxyphenyl)acetyl]amino]-4H-indeno[2,1-b]thiophene-1-carboxylate |
|---|---|
| PubChem CID | 71701806 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | ethyl 6,7-dimethoxy-2-[[2-(4-methoxyphenyl)acetyl]amino]-4H-indeno[2,1-b]thiophene-1-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Cc2ccc(OC)cc2)sc2c1-c1cc(OC)c(OC)cc1C2 |
| InChI | InChI=1S/C25H25NO6S/c1-5-32-25(28)23-22-17-13-19(31-4)18(30-3)11-15(17)12-20(22)33-24(23)26-21(27)10-14-6-8-16(29-2)9-7-14/h6-9,11,13H,5,10,12H2,1-4H3,(H,26,27) |
| InChIKey | DGHJADKEYDZIEC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|