C24H29NO6S — CID 97264936
ethyl 2-[[(4S)-2,2-dimethyloxane-4-carbonyl]amino]-6,7-dimethoxy-4H-indeno[2,1-b]thiophene-1-carboxylate (PubChem CID 97264936) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is ethyl 2-[[(4S)-2,2-dimethyloxane-4-carbonyl]amino]-6,7-dimethoxy-4H-indeno[2,1-b]thiophene-1-carboxylate.
| Compound Name | ethyl 2-[[(4S)-2,2-dimethyloxane-4-carbonyl]amino]-6,7-dimethoxy-4H-indeno[2,1-b]thiophene-1-carboxylate |
|---|---|
| PubChem CID | 97264936 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | ethyl 2-[[(4S)-2,2-dimethyloxane-4-carbonyl]amino]-6,7-dimethoxy-4H-indeno[2,1-b]thiophene-1-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@H]2CCOC(C)(C)C2)sc2c1-c1cc(OC)c(OC)cc1C2 |
| InChI | InChI=1S/C24H29NO6S/c1-6-30-23(27)20-19-15-11-17(29-5)16(28-4)9-14(15)10-18(19)32-22(20)25-21(26)13-7-8-31-24(2,3)12-13/h9,11,13H,6-8,10,12H2,1-5H3,(H,25,26)/t13-/m0/s1 |
| InChIKey | VSMXDQBQIHPXKI-ZDUSSCGKSA-N |
| XLogP | 4.66 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|