C21H19NO3 — CID 140704607
ethyl 2-(5-cyano-14-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)acetate (PubChem CID 140704607) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethyl 2-(5-cyano-14-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)acetate.
| Compound Name | ethyl 2-(5-cyano-14-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)acetate |
|---|---|
| PubChem CID | 140704607 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | ethyl 2-(5-cyano-14-methoxy-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)acetate |
| SMILES | CCOC(=O)CC1=Cc2ccc(OC)cc2Cc2cc(C#N)ccc21 |
| InChI | InChI=1S/C21H19NO3/c1-3-25-21(23)12-18-9-15-5-6-19(24-2)11-16(15)10-17-8-14(13-22)4-7-20(17)18/h4-9,11H,3,10,12H2,1-2H3 |
| InChIKey | PLMSGPZIJQAQCT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|