C15H22O — CID 101475135
(2E,8E,10Z)-2-methylcyclotetradeca-2,8,10-trien-1-one (PubChem CID 101475135) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2E,8E,10Z)-2-methylcyclotetradeca-2,8,10-trien-1-one.
| Compound Name | (2E,8E,10Z)-2-methylcyclotetradeca-2,8,10-trien-1-one |
|---|---|
| PubChem CID | 101475135 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2E,8E,10Z)-2-methylcyclotetradeca-2,8,10-trien-1-one |
| SMILES | C/C1=C\CCCC/C=C/C=C\CCCC1=O |
| InChI | InChI=1S/C15H22O/c1-14-12-10-8-6-4-2-3-5-7-9-11-13-15(14)16/h2-3,5,7,12H,4,6,8-11,13H2,1H3/b3-2+,7-5-,14-12+ |
| InChIKey | IPEYYLDMIQVSNS-ARIBBDHCSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |