C11H15N — CID 58219752
2-penta-2,4-dienylcyclohexa-1,3-dien-1-amine (PubChem CID 58219752) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-penta-2,4-dienylcyclohexa-1,3-dien-1-amine.
| Compound Name | 2-penta-2,4-dienylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 58219752 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2-penta-2,4-dienylcyclohexa-1,3-dien-1-amine |
| SMILES | C=CC=CCC1=C(N)CCC=C1 |
| InChI | InChI=1S/C11H15N/c1-2-3-4-7-10-8-5-6-9-11(10)12/h2-5,8H,1,6-7,9,12H2 |
| InChIKey | RWRFIMMHCJHRST-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|