C10H11Se — CID 6914078
CID 6914078 (PubChem CID 6914078) has the molecular formula C10H11Se and a molecular weight of 210.16 g/mol.
| Compound Name | CID 6914078 |
|---|---|
| PubChem CID | 6914078 |
| Molecular Formula | C10H11Se |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | — |
| SMILES | CCC1=C([Se])/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C10H11Se/c1-2-9-7-5-3-4-6-8-10(9)11/h3-8H,2H2,1H3/b4-3-,5-3-,6-4-,7-5-,8-6-,9-7-,10-8+,10-9+ |
| InChIKey | AJYNQRXQXVAMIY-AXMJBYMSSA-N |
| XLogP | 2.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|