C12H17N — CID 123479326
1-(2-ethylcyclohepta-1,3,5-trien-1-yl)propan-2-imine (PubChem CID 123479326) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-(2-ethylcyclohepta-1,3,5-trien-1-yl)propan-2-imine.
| Compound Name | 1-(2-ethylcyclohepta-1,3,5-trien-1-yl)propan-2-imine |
|---|---|
| PubChem CID | 123479326 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-(2-ethylcyclohepta-1,3,5-trien-1-yl)propan-2-imine |
| SMILES | [H]/N=C(\C)CC1=C(CC)C=CC=CC1 |
| InChI | InChI=1S/C12H17N/c1-3-11-7-5-4-6-8-12(11)9-10(2)13/h4-7,13H,3,8-9H2,1-2H3/b13-10+ |
| InChIKey | BZIDSBYTHGDVTQ-JLHYYAGUSA-N |
| XLogP | 3.64 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|