About 2-(2-iminopropyl)phenol;manganese
2-(2-iminopropyl)phenol;manganese (PubChem CID 174719483) has the molecular formula C9H11MnNO
and a molecular weight of 204.13 g/mol. Its IUPAC name is 2-(2-iminopropyl)phenol;manganese.
Molecular Properties
| Compound Name | 2-(2-iminopropyl)phenol;manganese |
| PubChem CID | 174719483 |
| Molecular Formula | C9H11MnNO |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-(2-iminopropyl)phenol;manganese |
| SMILES | [H]/N=C(\C)Cc1ccccc1O.[Mn] |
| InChI | InChI=1S/C9H11NO.Mn/c1-7(10)6-8-4-2-3-5-9(8)11;/h2-5,10-11H,6H2,1H3;/b10-7+; |
| InChIKey | BOOCPPNSIPJDDO-HCUGZAAXSA-N |
| XLogP | 1.97 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iminopropyl)phenol;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iminopropyl)phenol;manganese?
The IUPAC name of 2-(2-iminopropyl)phenol;manganese (CID 174719483) is 2-(2-iminopropyl)phenol;manganese.
What is the SMILES notation for 2-(2-iminopropyl)phenol;manganese?
The canonical SMILES for 2-(2-iminopropyl)phenol;manganese is [H]/N=C(\C)Cc1ccccc1O.[Mn].
What is the InChIKey of 2-(2-iminopropyl)phenol;manganese?
The InChIKey is BOOCPPNSIPJDDO-HCUGZAAXSA-N. The full InChI is InChI=1S/C9H11NO.Mn/c1-7(10)6-8-4-2-3-5-9(8)11;/h2-5,10-11H,6H2,1H3;/b10-7+;.
What are the key properties of 2-(2-iminopropyl)phenol;manganese?
2-(2-iminopropyl)phenol;manganese has a molecular weight of 204.13 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iminopropyl)phenol;manganese is sourced from PubChem (CID 174719483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).