About 2-(2-iminoethyl)phenol
2-(2-iminoethyl)phenol (PubChem CID 90112038) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-(2-iminoethyl)phenol.
Molecular Properties
| Compound Name | 2-(2-iminoethyl)phenol |
| PubChem CID | 90112038 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-(2-iminoethyl)phenol |
| SMILES | [H]/N=C/Cc1ccccc1O |
| InChI | InChI=1S/C8H9NO/c9-6-5-7-3-1-2-4-8(7)10/h1-4,6,9-10H,5H2/b9-6+ |
| InChIKey | WBABVVMCTALUHF-RMKNXTFCSA-N |
| XLogP | 1.58 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iminoethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iminoethyl)phenol?
The IUPAC name of 2-(2-iminoethyl)phenol (CID 90112038) is 2-(2-iminoethyl)phenol.
What is the SMILES notation for 2-(2-iminoethyl)phenol?
The canonical SMILES for 2-(2-iminoethyl)phenol is [H]/N=C/Cc1ccccc1O.
What is the InChIKey of 2-(2-iminoethyl)phenol?
The InChIKey is WBABVVMCTALUHF-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H9NO/c9-6-5-7-3-1-2-4-8(7)10/h1-4,6,9-10H,5H2/b9-6+.
What are the key properties of 2-(2-iminoethyl)phenol?
2-(2-iminoethyl)phenol has a molecular weight of 135.17 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iminoethyl)phenol is sourced from PubChem (CID 90112038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).