C12H11NO2 — CID 91312623
2-(2-iminoethyl)naphthalene-1,4-diol (PubChem CID 91312623) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(2-iminoethyl)naphthalene-1,4-diol.
| Compound Name | 2-(2-iminoethyl)naphthalene-1,4-diol |
|---|---|
| PubChem CID | 91312623 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-(2-iminoethyl)naphthalene-1,4-diol |
| SMILES | [H]/N=C/Cc1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C12H11NO2/c13-6-5-8-7-11(14)9-3-1-2-4-10(9)12(8)15/h1-4,6-7,13-15H,5H2/b13-6+ |
| InChIKey | TYNHVNALNJZNDI-AWNIVKPZSA-N |
| XLogP | 2.44 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|