C18H20O — CID 126583308
3-ethyl-4-[(2E,4Z)-hexa-2,4-dien-3-yl]naphthalen-1-ol (PubChem CID 126583308) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-ethyl-4-[(2E,4Z)-hexa-2,4-dien-3-yl]naphthalen-1-ol.
| Compound Name | 3-ethyl-4-[(2E,4Z)-hexa-2,4-dien-3-yl]naphthalen-1-ol |
|---|---|
| PubChem CID | 126583308 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 3-ethyl-4-[(2E,4Z)-hexa-2,4-dien-3-yl]naphthalen-1-ol |
| SMILES | C/C=C\C(=C/C)c1c(CC)cc(O)c2ccccc12 |
| InChI | InChI=1S/C18H20O/c1-4-9-13(5-2)18-14(6-3)12-17(19)15-10-7-8-11-16(15)18/h4-5,7-12,19H,6H2,1-3H3/b9-4-,13-5+ |
| InChIKey | MXWQQBKQPHETSQ-SMFODQAKSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|