C12H14O — CID 141457123
2-(4-methylpenta-2,4-dienyl)phenol (PubChem CID 141457123) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-(4-methylpenta-2,4-dienyl)phenol.
| Compound Name | 2-(4-methylpenta-2,4-dienyl)phenol |
|---|---|
| PubChem CID | 141457123 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-(4-methylpenta-2,4-dienyl)phenol |
| SMILES | C=C(C)C=CCc1ccccc1O |
| InChI | InChI=1S/C12H14O/c1-10(2)6-5-8-11-7-3-4-9-12(11)13/h3-7,9,13H,1,8H2,2H3 |
| InChIKey | DDWVLQCEPJTZEX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|