About 2-[(E)-hex-3-enyl]phenol
2-[(E)-hex-3-enyl]phenol (PubChem CID 21272840) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[(E)-hex-3-enyl]phenol.
Molecular Properties
| Compound Name | 2-[(E)-hex-3-enyl]phenol |
| PubChem CID | 21272840 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-[(E)-hex-3-enyl]phenol |
| SMILES | CC/C=C/CCc1ccccc1O |
| InChI | InChI=1S/C12H16O/c1-2-3-4-5-8-11-9-6-7-10-12(11)13/h3-4,6-7,9-10,13H,2,5,8H2,1H3/b4-3+ |
| InChIKey | HYHPBMZRSKGNTO-ONEGZZNKSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-hex-3-enyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-hex-3-enyl]phenol?
The IUPAC name of 2-[(E)-hex-3-enyl]phenol (CID 21272840) is 2-[(E)-hex-3-enyl]phenol.
What is the SMILES notation for 2-[(E)-hex-3-enyl]phenol?
The canonical SMILES for 2-[(E)-hex-3-enyl]phenol is CC/C=C/CCc1ccccc1O.
What is the InChIKey of 2-[(E)-hex-3-enyl]phenol?
The InChIKey is HYHPBMZRSKGNTO-ONEGZZNKSA-N. The full InChI is InChI=1S/C12H16O/c1-2-3-4-5-8-11-9-6-7-10-12(11)13/h3-4,6-7,9-10,13H,2,5,8H2,1H3/b4-3+.
What are the key properties of 2-[(E)-hex-3-enyl]phenol?
2-[(E)-hex-3-enyl]phenol has a molecular weight of 176.26 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-hex-3-enyl]phenol is sourced from PubChem (CID 21272840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).