About 2-(3-prop-2-enylhexa-2,5-dienyl)phenol
2-(3-prop-2-enylhexa-2,5-dienyl)phenol (PubChem CID 70595420) has the molecular formula C15H18O
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(3-prop-2-enylhexa-2,5-dienyl)phenol.
Molecular Properties
| Compound Name | 2-(3-prop-2-enylhexa-2,5-dienyl)phenol |
| PubChem CID | 70595420 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-(3-prop-2-enylhexa-2,5-dienyl)phenol |
| SMILES | C=CCC(=CCc1ccccc1O)CC=C |
| InChI | InChI=1S/C15H18O/c1-3-7-13(8-4-2)11-12-14-9-5-6-10-15(14)16/h3-6,9-11,16H,1-2,7-8,12H2 |
| InChIKey | RRKVSZRYVCIVFI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-prop-2-enylhexa-2,5-dienyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-prop-2-enylhexa-2,5-dienyl)phenol?
The IUPAC name of 2-(3-prop-2-enylhexa-2,5-dienyl)phenol (CID 70595420) is 2-(3-prop-2-enylhexa-2,5-dienyl)phenol.
What is the SMILES notation for 2-(3-prop-2-enylhexa-2,5-dienyl)phenol?
The canonical SMILES for 2-(3-prop-2-enylhexa-2,5-dienyl)phenol is C=CCC(=CCc1ccccc1O)CC=C.
What is the InChIKey of 2-(3-prop-2-enylhexa-2,5-dienyl)phenol?
The InChIKey is RRKVSZRYVCIVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O/c1-3-7-13(8-4-2)11-12-14-9-5-6-10-15(14)16/h3-6,9-11,16H,1-2,7-8,12H2.
What are the key properties of 2-(3-prop-2-enylhexa-2,5-dienyl)phenol?
2-(3-prop-2-enylhexa-2,5-dienyl)phenol has a molecular weight of 214.31 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-prop-2-enylhexa-2,5-dienyl)phenol is sourced from PubChem (CID 70595420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).