C16H14O3 — CID 142713129
2,4-bis(2-hydroxyphenyl)but-2-enal (PubChem CID 142713129) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2,4-bis(2-hydroxyphenyl)but-2-enal.
| Compound Name | 2,4-bis(2-hydroxyphenyl)but-2-enal |
|---|---|
| PubChem CID | 142713129 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2,4-bis(2-hydroxyphenyl)but-2-enal |
| SMILES | O=CC(=CCc1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C16H14O3/c17-11-13(14-6-2-4-8-16(14)19)10-9-12-5-1-3-7-15(12)18/h1-8,10-11,18-19H,9H2 |
| InChIKey | HWLUIDGFAWTAMU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|