About morpholine;2-prop-2-enylphenol
morpholine;2-prop-2-enylphenol (PubChem CID 174570096) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is morpholine;2-prop-2-enylphenol.
Molecular Properties
| Compound Name | morpholine;2-prop-2-enylphenol |
| PubChem CID | 174570096 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | morpholine;2-prop-2-enylphenol |
| SMILES | C1COCCN1.C=CCc1ccccc1O |
| InChI | InChI=1S/C9H10O.C4H9NO/c1-2-5-8-6-3-4-7-9(8)10;1-3-6-4-2-5-1/h2-4,6-7,10H,1,5H2;5H,1-4H2 |
| InChIKey | CXTILRWFGILDBE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze morpholine;2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;2-prop-2-enylphenol?
The IUPAC name of morpholine;2-prop-2-enylphenol (CID 174570096) is morpholine;2-prop-2-enylphenol.
What is the SMILES notation for morpholine;2-prop-2-enylphenol?
The canonical SMILES for morpholine;2-prop-2-enylphenol is C1COCCN1.C=CCc1ccccc1O.
What is the InChIKey of morpholine;2-prop-2-enylphenol?
The InChIKey is CXTILRWFGILDBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C4H9NO/c1-2-5-8-6-3-4-7-9(8)10;1-3-6-4-2-5-1/h2-4,6-7,10H,1,5H2;5H,1-4H2.
What are the key properties of morpholine;2-prop-2-enylphenol?
morpholine;2-prop-2-enylphenol has a molecular weight of 221.30 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;2-prop-2-enylphenol is sourced from PubChem (CID 174570096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).