About 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol
1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol (PubChem CID 67837577) has the molecular formula C17H28N4O2
and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol.
Molecular Properties
| Compound Name | 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol |
| PubChem CID | 67837577 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol |
| SMILES | C1CN(ON2CCNCC2)CCN1.C=CCc1ccccc1O |
| InChI | InChI=1S/C9H10O.C8H18N4O/c1-2-5-8-6-3-4-7-9(8)10;1-5-11(6-2-9-1)13-12-7-3-10-4-8-12/h2-4,6-7,10H,1,5H2;9-10H,1-8H2 |
| InChIKey | RPRWYQJJMGMPGU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol?
The IUPAC name of 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol (CID 67837577) is 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol.
What is the SMILES notation for 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol?
The canonical SMILES for 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol is C1CN(ON2CCNCC2)CCN1.C=CCc1ccccc1O.
What is the InChIKey of 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol?
The InChIKey is RPRWYQJJMGMPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C8H18N4O/c1-2-5-8-6-3-4-7-9(8)10;1-5-11(6-2-9-1)13-12-7-3-10-4-8-12/h2-4,6-7,10H,1,5H2;9-10H,1-8H2.
What are the key properties of 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol?
1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol has a molecular weight of 320.44 g/mol, XLogP of 0.76, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-yloxypiperazine;2-prop-2-enylphenol is sourced from PubChem (CID 67837577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).