About morpholine;prop-2-enoic acid;styrene
morpholine;prop-2-enoic acid;styrene (PubChem CID 6455850) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is morpholine;prop-2-enoic acid;styrene.
Molecular Properties
| Compound Name | morpholine;prop-2-enoic acid;styrene |
| PubChem CID | 6455850 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | morpholine;prop-2-enoic acid;styrene |
| SMILES | C1COCCN1.C=CC(=O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C4H9NO.C3H4O2/c1-2-8-6-4-3-5-7-8;1-3-6-4-2-5-1;1-2-3(4)5/h2-7H,1H2;5H,1-4H2;2H,1H2,(H,4,5) |
| InChIKey | UYCSZXSDNKOMCV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze morpholine;prop-2-enoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;prop-2-enoic acid;styrene?
The IUPAC name of morpholine;prop-2-enoic acid;styrene (CID 6455850) is morpholine;prop-2-enoic acid;styrene.
What is the SMILES notation for morpholine;prop-2-enoic acid;styrene?
The canonical SMILES for morpholine;prop-2-enoic acid;styrene is C1COCCN1.C=CC(=O)O.C=Cc1ccccc1.
What is the InChIKey of morpholine;prop-2-enoic acid;styrene?
The InChIKey is UYCSZXSDNKOMCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C4H9NO.C3H4O2/c1-2-8-6-4-3-5-7-8;1-3-6-4-2-5-1;1-2-3(4)5/h2-7H,1H2;5H,1-4H2;2H,1H2,(H,4,5).
What are the key properties of morpholine;prop-2-enoic acid;styrene?
morpholine;prop-2-enoic acid;styrene has a molecular weight of 263.34 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;prop-2-enoic acid;styrene is sourced from PubChem (CID 6455850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).