About (2-hydroxyphenyl)methyl 2-methylpropanimidate
(2-hydroxyphenyl)methyl 2-methylpropanimidate (PubChem CID 58806992) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (2-hydroxyphenyl)methyl 2-methylpropanimidate.
Molecular Properties
| Compound Name | (2-hydroxyphenyl)methyl 2-methylpropanimidate |
| PubChem CID | 58806992 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2-hydroxyphenyl)methyl 2-methylpropanimidate |
| SMILES | [H]/N=C(/OCc1ccccc1O)C(C)C |
| InChI | InChI=1S/C11H15NO2/c1-8(2)11(12)14-7-9-5-3-4-6-10(9)13/h3-6,8,12-13H,7H2,1-2H3/b12-11+ |
| InChIKey | WNZNVNJQNDDYPH-VAWYXSNFSA-N |
| XLogP | 2.54 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl)methyl 2-methylpropanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl)methyl 2-methylpropanimidate?
The IUPAC name of (2-hydroxyphenyl)methyl 2-methylpropanimidate (CID 58806992) is (2-hydroxyphenyl)methyl 2-methylpropanimidate.
What is the SMILES notation for (2-hydroxyphenyl)methyl 2-methylpropanimidate?
The canonical SMILES for (2-hydroxyphenyl)methyl 2-methylpropanimidate is [H]/N=C(/OCc1ccccc1O)C(C)C.
What is the InChIKey of (2-hydroxyphenyl)methyl 2-methylpropanimidate?
The InChIKey is WNZNVNJQNDDYPH-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H15NO2/c1-8(2)11(12)14-7-9-5-3-4-6-10(9)13/h3-6,8,12-13H,7H2,1-2H3/b12-11+.
What are the key properties of (2-hydroxyphenyl)methyl 2-methylpropanimidate?
(2-hydroxyphenyl)methyl 2-methylpropanimidate has a molecular weight of 193.25 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl)methyl 2-methylpropanimidate is sourced from PubChem (CID 58806992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).