C20H26CaO2 — CID 140751950
calcium bis(2-propylcyclohepta-1,3,5-trien-1-olate) (PubChem CID 140751950) has the molecular formula C20H26CaO2 and a molecular weight of 338.50 g/mol. Its IUPAC name is calcium bis(2-propylcyclohepta-1,3,5-trien-1-olate).
| Compound Name | calcium bis(2-propylcyclohepta-1,3,5-trien-1-olate) |
|---|---|
| PubChem CID | 140751950 |
| Molecular Formula | C20H26CaO2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | calcium bis(2-propylcyclohepta-1,3,5-trien-1-olate) |
| SMILES | CCCC1=C([O-])CC=CC=C1.CCCC1=C([O-])CC=CC=C1.[Ca+2] |
| InChI | InChI=1S/2C10H14O.Ca/c2*1-2-6-9-7-4-3-5-8-10(9)11;/h2*3-5,7,11H,2,6,8H2,1H3;/q;;+2/p-2 |
| InChIKey | QTDXYSWRWSPUPL-UHFFFAOYSA-L |
| XLogP | 3.45 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |