C10H14FNO — CID 167447240
2-fluoro-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 167447240) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-fluoro-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 2-fluoro-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 167447240 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-fluoro-N-propan-2-ylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC(C)NC(=O)C1=C(F)CCC=C1 |
| InChI | InChI=1S/C10H14FNO/c1-7(2)12-10(13)8-5-3-4-6-9(8)11/h3,5,7H,4,6H2,1-2H3,(H,12,13) |
| InChIKey | AFQIYBYUMLKQQK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |