About ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine
ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine (PubChem CID 170615049) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine |
| PubChem CID | 170615049 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine |
| SMILES | C/C=C(/NC(C)C)C1=C(NC)CCC=C1.CC |
| InChI | InChI=1S/C13H22N2.C2H6/c1-5-12(15-10(2)3)11-8-6-7-9-13(11)14-4;1-2/h5-6,8,10,14-15H,7,9H2,1-4H3;1-2H3/b12-5+; |
| InChIKey | FGKWWEAAZDCUAG-NKPNRJPBSA-N |
| XLogP | 3.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine?
The IUPAC name of ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine (CID 170615049) is ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine.
What is the SMILES notation for ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine?
The canonical SMILES for ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine is C/C=C(/NC(C)C)C1=C(NC)CCC=C1.CC.
What is the InChIKey of ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine?
The InChIKey is FGKWWEAAZDCUAG-NKPNRJPBSA-N. The full InChI is InChI=1S/C13H22N2.C2H6/c1-5-12(15-10(2)3)11-8-6-7-9-13(11)14-4;1-2/h5-6,8,10,14-15H,7,9H2,1-4H3;1-2H3/b12-5+;.
What are the key properties of ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine?
ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine has a molecular weight of 236.40 g/mol, XLogP of 3.74, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-2-[(E)-1-(propan-2-ylamino)prop-1-enyl]cyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 170615049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).