C13H18 — CID 101316499
4-propan-2-yl-1,2,5,8-tetrahydronaphthalene (PubChem CID 101316499) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 4-propan-2-yl-1,2,5,8-tetrahydronaphthalene.
| Compound Name | 4-propan-2-yl-1,2,5,8-tetrahydronaphthalene |
|---|---|
| PubChem CID | 101316499 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 4-propan-2-yl-1,2,5,8-tetrahydronaphthalene |
| SMILES | CC(C)C1=CCCC2=C1CC=CC2 |
| InChI | InChI=1S/C13H18/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | JPWPUEUWPLDJID-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|