About [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite
[2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite (PubChem CID 146622902) has the molecular formula C12H19IO
and a molecular weight of 306.19 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite.
Molecular Properties
| Compound Name | [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite |
| PubChem CID | 146622902 |
| Molecular Formula | C12H19IO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite |
| SMILES | CC(C)C1=CCCC(C(C)C)=C1OI |
| InChI | InChI=1S/C12H19IO/c1-8(2)10-6-5-7-11(9(3)4)12(10)14-13/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | LOXQFGYMLRFBSG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite?
The IUPAC name of [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite (CID 146622902) is [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite.
What is the SMILES notation for [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite?
The canonical SMILES for [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite is CC(C)C1=CCCC(C(C)C)=C1OI.
What is the InChIKey of [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite?
The InChIKey is LOXQFGYMLRFBSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19IO/c1-8(2)10-6-5-7-11(9(3)4)12(10)14-13/h6,8-9H,5,7H2,1-4H3.
What are the key properties of [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite?
[2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite has a molecular weight of 306.19 g/mol, XLogP of 4.64, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite is sourced from PubChem (CID 146622902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).