C12H19IO — CID 146622902
[2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite (PubChem CID 146622902) has the molecular formula C12H19IO and a molecular weight of 306.19 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite.
| Compound Name | [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite |
|---|---|
| PubChem CID | 146622902 |
| Molecular Formula | C12H19IO |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | [2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl] hypoiodite |
| SMILES | CC(C)C1=CCCC(C(C)C)=C1OI |
| InChI | InChI=1S/C12H19IO/c1-8(2)10-6-5-7-11(9(3)4)12(10)14-13/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | LOXQFGYMLRFBSG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|