C15H26 — CID 139667593
2-butyl-1,3-di(propan-2-yl)cyclopenta-1,3-diene (PubChem CID 139667593) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 2-butyl-1,3-di(propan-2-yl)cyclopenta-1,3-diene.
| Compound Name | 2-butyl-1,3-di(propan-2-yl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 139667593 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 2-butyl-1,3-di(propan-2-yl)cyclopenta-1,3-diene |
| SMILES | CCCCC1=C(C(C)C)CC=C1C(C)C |
| InChI | InChI=1S/C15H26/c1-6-7-8-15-13(11(2)3)9-10-14(15)12(4)5/h9,11-12H,6-8,10H2,1-5H3 |
| InChIKey | JCKRCYZYHHESRP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |