C38H50Si — CID 140588633
tris(4-butylphenyl)-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 140588633) has the molecular formula C38H50Si and a molecular weight of 534.90 g/mol. Its IUPAC name is tris(4-butylphenyl)-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(4-butylphenyl)-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 140588633 |
| Molecular Formula | C38H50Si |
| Molecular Weight | 534.90 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | tris(4-butylphenyl)-(3-propan-2-ylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CCCCc1ccc([Si](C2=CC(C(C)C)=CC2)(c2ccc(CCCC)cc2)c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C38H50Si/c1-6-9-12-31-15-22-35(23-16-31)39(38-28-21-34(29-38)30(4)5,36-24-17-32(18-25-36)13-10-7-2)37-26-19-33(20-27-37)14-11-8-3/h15-27,29-30H,6-14,28H2,1-5H3 |
| InChIKey | HXGJAATYPWLANQ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.90 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|